C9H13NS3 — CID 79970704
1,4-dithian-2-yl(thiophen-3-yl)methanamine (PubChem CID 79970704) has the molecular formula C9H13NS3 and a molecular weight of 231.41 g/mol. Its IUPAC name is 1,4-dithian-2-yl(thiophen-3-yl)methanamine.
| Compound Name | 1,4-dithian-2-yl(thiophen-3-yl)methanamine |
|---|---|
| PubChem CID | 79970704 |
| Molecular Formula | C9H13NS3 |
| Molecular Weight | 231.41 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | 1,4-dithian-2-yl(thiophen-3-yl)methanamine |
| SMILES | NC(c1ccsc1)C1CSCCS1 |
| InChI | InChI=1S/C9H13NS3/c10-9(7-1-2-11-5-7)8-6-12-3-4-13-8/h1-2,5,8-9H,3-4,6,10H2 |
| InChIKey | GAFZEULHRFHDNY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |