C11H16OS3 — CID 115386492
(3-ethyl-1,4-dithian-2-yl)-thiophen-3-ylmethanol (PubChem CID 115386492) has the molecular formula C11H16OS3 and a molecular weight of 260.45 g/mol. Its IUPAC name is (3-ethyl-1,4-dithian-2-yl)-thiophen-3-ylmethanol.
| Compound Name | (3-ethyl-1,4-dithian-2-yl)-thiophen-3-ylmethanol |
|---|---|
| PubChem CID | 115386492 |
| Molecular Formula | C11H16OS3 |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | (3-ethyl-1,4-dithian-2-yl)-thiophen-3-ylmethanol |
| SMILES | CCC1SCCSC1C(O)c1ccsc1 |
| InChI | InChI=1S/C11H16OS3/c1-2-9-11(15-6-5-14-9)10(12)8-3-4-13-7-8/h3-4,7,9-12H,2,5-6H2,1H3 |
| InChIKey | JJXGSDUPICMSPF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |