C15H22O3S2 — CID 115386537
(2,5-dimethoxyphenyl)-(3-ethyl-1,4-dithian-2-yl)methanol (PubChem CID 115386537) has the molecular formula C15H22O3S2 and a molecular weight of 314.47 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl)-(3-ethyl-1,4-dithian-2-yl)methanol.
| Compound Name | (2,5-dimethoxyphenyl)-(3-ethyl-1,4-dithian-2-yl)methanol |
|---|---|
| PubChem CID | 115386537 |
| Molecular Formula | C15H22O3S2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | (2,5-dimethoxyphenyl)-(3-ethyl-1,4-dithian-2-yl)methanol |
| SMILES | CCC1SCCSC1C(O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C15H22O3S2/c1-4-13-15(20-8-7-19-13)14(16)11-9-10(17-2)5-6-12(11)18-3/h5-6,9,13-16H,4,7-8H2,1-3H3 |
| InChIKey | NEPHPXYDERSGQG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |