C13H16F3NO2S — CID 103595745
(4-methylthiomorpholin-3-yl)-[3-(trifluoromethoxy)phenyl]methanol (PubChem CID 103595745) has the molecular formula C13H16F3NO2S and a molecular weight of 307.34 g/mol. Its IUPAC name is (4-methylthiomorpholin-3-yl)-[3-(trifluoromethoxy)phenyl]methanol.
| Compound Name | (4-methylthiomorpholin-3-yl)-[3-(trifluoromethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 103595745 |
| Molecular Formula | C13H16F3NO2S |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | (4-methylthiomorpholin-3-yl)-[3-(trifluoromethoxy)phenyl]methanol |
| SMILES | CN1CCSCC1C(O)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C13H16F3NO2S/c1-17-5-6-20-8-11(17)12(18)9-3-2-4-10(7-9)19-13(14,15)16/h2-4,7,11-12,18H,5-6,8H2,1H3 |
| InChIKey | GHBVPADVBXTCQE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |