C13H13F3N2O2 — CID 107105009
2-(1-methylpyrazol-4-yl)-1-[3-(trifluoromethoxy)phenyl]ethanol (PubChem CID 107105009) has the molecular formula C13H13F3N2O2 and a molecular weight of 286.25 g/mol. Its IUPAC name is 2-(1-methylpyrazol-4-yl)-1-[3-(trifluoromethoxy)phenyl]ethanol.
| Compound Name | 2-(1-methylpyrazol-4-yl)-1-[3-(trifluoromethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 107105009 |
| Molecular Formula | C13H13F3N2O2 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 2-(1-methylpyrazol-4-yl)-1-[3-(trifluoromethoxy)phenyl]ethanol |
| SMILES | Cn1cc(CC(O)c2cccc(OC(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C13H13F3N2O2/c1-18-8-9(7-17-18)5-12(19)10-3-2-4-11(6-10)20-13(14,15)16/h2-4,6-8,12,19H,5H2,1H3 |
| InChIKey | FEDJTBNVDQNRLV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |