C13H13F3N2O2 — CID 83090224
(1,3-dimethylpyrazol-4-yl)-[3-(trifluoromethoxy)phenyl]methanol (PubChem CID 83090224) has the molecular formula C13H13F3N2O2 and a molecular weight of 286.25 g/mol. Its IUPAC name is (1,3-dimethylpyrazol-4-yl)-[3-(trifluoromethoxy)phenyl]methanol.
| Compound Name | (1,3-dimethylpyrazol-4-yl)-[3-(trifluoromethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 83090224 |
| Molecular Formula | C13H13F3N2O2 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | (1,3-dimethylpyrazol-4-yl)-[3-(trifluoromethoxy)phenyl]methanol |
| SMILES | Cc1nn(C)cc1C(O)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F3N2O2/c1-8-11(7-18(2)17-8)12(19)9-4-3-5-10(6-9)20-13(14,15)16/h3-7,12,19H,1-2H3 |
| InChIKey | ZVBRXIRCICVYMP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |