C13H16N2O — CID 83090741
(1,3-dimethylpyrazol-4-yl)-(4-methylphenyl)methanol (PubChem CID 83090741) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is (1,3-dimethylpyrazol-4-yl)-(4-methylphenyl)methanol.
| Compound Name | (1,3-dimethylpyrazol-4-yl)-(4-methylphenyl)methanol |
|---|---|
| PubChem CID | 83090741 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | (1,3-dimethylpyrazol-4-yl)-(4-methylphenyl)methanol |
| SMILES | Cc1ccc(C(O)c2cn(C)nc2C)cc1 |
| InChI | InChI=1S/C13H16N2O/c1-9-4-6-11(7-5-9)13(16)12-8-15(3)14-10(12)2/h4-8,13,16H,1-3H3 |
| InChIKey | MGWBKPZMAGCKRG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |