C16H22N2O — CID 83092098
(4-tert-butylphenyl)-(1,3-dimethylpyrazol-4-yl)methanol (PubChem CID 83092098) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is (4-tert-butylphenyl)-(1,3-dimethylpyrazol-4-yl)methanol.
| Compound Name | (4-tert-butylphenyl)-(1,3-dimethylpyrazol-4-yl)methanol |
|---|---|
| PubChem CID | 83092098 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (4-tert-butylphenyl)-(1,3-dimethylpyrazol-4-yl)methanol |
| SMILES | Cc1nn(C)cc1C(O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H22N2O/c1-11-14(10-18(5)17-11)15(19)12-6-8-13(9-7-12)16(2,3)4/h6-10,15,19H,1-5H3 |
| InChIKey | VIVRXDIZIQZIAK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |