C7H10F2N2O — CID 95567318
(1S)-1-(1,3-dimethylpyrazol-4-yl)-2,2-difluoroethanol (PubChem CID 95567318) has the molecular formula C7H10F2N2O and a molecular weight of 176.17 g/mol. Its IUPAC name is (1S)-1-(1,3-dimethylpyrazol-4-yl)-2,2-difluoroethanol.
| Compound Name | (1S)-1-(1,3-dimethylpyrazol-4-yl)-2,2-difluoroethanol |
|---|---|
| PubChem CID | 95567318 |
| Molecular Formula | C7H10F2N2O |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (1S)-1-(1,3-dimethylpyrazol-4-yl)-2,2-difluoroethanol |
| SMILES | Cc1nn(C)cc1[C@H](O)C(F)F |
| InChI | InChI=1S/C7H10F2N2O/c1-4-5(3-11(2)10-4)6(12)7(8)9/h3,6-7,12H,1-2H3/t6-/m0/s1 |
| InChIKey | BZGHZDKZMZCECO-LURJTMIESA-N |
| XLogP | 1.03 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |