C7H14N3+ — CID 7019316
[(1R)-1-(1,3-dimethylpyrazol-4-yl)ethyl]azanium (PubChem CID 7019316) has the molecular formula C7H14N3+ and a molecular weight of 140.21 g/mol. Its IUPAC name is [(1R)-1-(1,3-dimethylpyrazol-4-yl)ethyl]azanium.
| Compound Name | [(1R)-1-(1,3-dimethylpyrazol-4-yl)ethyl]azanium |
|---|---|
| PubChem CID | 7019316 |
| Molecular Formula | C7H14N3+ |
| Molecular Weight | 140.21 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | [(1R)-1-(1,3-dimethylpyrazol-4-yl)ethyl]azanium |
| SMILES | Cc1nn(C)cc1[C@@H](C)[NH3+] |
| InChI | InChI=1S/C7H13N3/c1-5(8)7-4-10(3)9-6(7)2/h4-5H,8H2,1-3H3/p+1/t5-/m1/s1 |
| InChIKey | ZHCIXQMRFVTGGF-RXMQYKEDSA-O |
| XLogP | 0.03 |
| TPSA | 45.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.21 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |