C11H16F2N2 — CID 173077766
4-[1-(3,3-difluorocyclobutyl)ethyl]-1,3-dimethylpyrazole (PubChem CID 173077766) has the molecular formula C11H16F2N2 and a molecular weight of 214.26 g/mol. Its IUPAC name is 4-[1-(3,3-difluorocyclobutyl)ethyl]-1,3-dimethylpyrazole.
| Compound Name | 4-[1-(3,3-difluorocyclobutyl)ethyl]-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 173077766 |
| Molecular Formula | C11H16F2N2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 4-[1-(3,3-difluorocyclobutyl)ethyl]-1,3-dimethylpyrazole |
| SMILES | Cc1nn(C)cc1C(C)C1CC(F)(F)C1 |
| InChI | InChI=1S/C11H16F2N2/c1-7(9-4-11(12,13)5-9)10-6-15(3)14-8(10)2/h6-7,9H,4-5H2,1-3H3 |
| InChIKey | UJGWLLIRIQZZRU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |