C11H18N2O — CID 102804709
2-cyclobutyl-1-(1,3-dimethylpyrazol-4-yl)ethanol (PubChem CID 102804709) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-cyclobutyl-1-(1,3-dimethylpyrazol-4-yl)ethanol.
| Compound Name | 2-cyclobutyl-1-(1,3-dimethylpyrazol-4-yl)ethanol |
|---|---|
| PubChem CID | 102804709 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 2-cyclobutyl-1-(1,3-dimethylpyrazol-4-yl)ethanol |
| SMILES | Cc1nn(C)cc1C(O)CC1CCC1 |
| InChI | InChI=1S/C11H18N2O/c1-8-10(7-13(2)12-8)11(14)6-9-4-3-5-9/h7,9,11,14H,3-6H2,1-2H3 |
| InChIKey | WVDCKJFXKYATCZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |