About cyclohexyl-(1,3-dimethylpyrazol-4-yl)methanol
cyclohexyl-(1,3-dimethylpyrazol-4-yl)methanol (PubChem CID 83090918) has the molecular formula C12H20N2O
and a molecular weight of 208.30 g/mol. Its IUPAC name is cyclohexyl-(1,3-dimethylpyrazol-4-yl)methanol.
Molecular Properties
| Compound Name | cyclohexyl-(1,3-dimethylpyrazol-4-yl)methanol |
| PubChem CID | 83090918 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | cyclohexyl-(1,3-dimethylpyrazol-4-yl)methanol |
| SMILES | Cc1nn(C)cc1C(O)C1CCCCC1 |
| InChI | InChI=1S/C12H20N2O/c1-9-11(8-14(2)13-9)12(15)10-6-4-3-5-7-10/h8,10,12,15H,3-7H2,1-2H3 |
| InChIKey | ZSRNTTPBVQIJHH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexyl-(1,3-dimethylpyrazol-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl-(1,3-dimethylpyrazol-4-yl)methanol?
The IUPAC name of cyclohexyl-(1,3-dimethylpyrazol-4-yl)methanol (CID 83090918) is cyclohexyl-(1,3-dimethylpyrazol-4-yl)methanol.
What is the SMILES notation for cyclohexyl-(1,3-dimethylpyrazol-4-yl)methanol?
The canonical SMILES for cyclohexyl-(1,3-dimethylpyrazol-4-yl)methanol is Cc1nn(C)cc1C(O)C1CCCCC1.
What is the InChIKey of cyclohexyl-(1,3-dimethylpyrazol-4-yl)methanol?
The InChIKey is ZSRNTTPBVQIJHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O/c1-9-11(8-14(2)13-9)12(15)10-6-4-3-5-7-10/h8,10,12,15H,3-7H2,1-2H3.
What are the key properties of cyclohexyl-(1,3-dimethylpyrazol-4-yl)methanol?
cyclohexyl-(1,3-dimethylpyrazol-4-yl)methanol has a molecular weight of 208.30 g/mol, XLogP of 2.34, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl-(1,3-dimethylpyrazol-4-yl)methanol is sourced from PubChem (CID 83090918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).