C12H20N2O — CID 83090918
cyclohexyl-(1,3-dimethylpyrazol-4-yl)methanol (PubChem CID 83090918) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is cyclohexyl-(1,3-dimethylpyrazol-4-yl)methanol.
| Compound Name | cyclohexyl-(1,3-dimethylpyrazol-4-yl)methanol |
|---|---|
| PubChem CID | 83090918 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | cyclohexyl-(1,3-dimethylpyrazol-4-yl)methanol |
| SMILES | Cc1nn(C)cc1C(O)C1CCCCC1 |
| InChI | InChI=1S/C12H20N2O/c1-9-11(8-14(2)13-9)12(15)10-6-4-3-5-7-10/h8,10,12,15H,3-7H2,1-2H3 |
| InChIKey | ZSRNTTPBVQIJHH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |