C14H19F3N2OS — CID 107104647
2-(3-methylthiomorpholin-4-yl)-2-[3-(trifluoromethoxy)phenyl]ethanamine (PubChem CID 107104647) has the molecular formula C14H19F3N2OS and a molecular weight of 320.38 g/mol. Its IUPAC name is 2-(3-methylthiomorpholin-4-yl)-2-[3-(trifluoromethoxy)phenyl]ethanamine.
| Compound Name | 2-(3-methylthiomorpholin-4-yl)-2-[3-(trifluoromethoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 107104647 |
| Molecular Formula | C14H19F3N2OS |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-(3-methylthiomorpholin-4-yl)-2-[3-(trifluoromethoxy)phenyl]ethanamine |
| SMILES | CC1CSCCN1C(CN)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C14H19F3N2OS/c1-10-9-21-6-5-19(10)13(8-18)11-3-2-4-12(7-11)20-14(15,16)17/h2-4,7,10,13H,5-6,8-9,18H2,1H3 |
| InChIKey | ZPSOEPGBOGDSBN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |