C14H19F3N2O2 — CID 107104696
2-(3-methoxypyrrolidin-1-yl)-2-[3-(trifluoromethoxy)phenyl]ethanamine (PubChem CID 107104696) has the molecular formula C14H19F3N2O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is 2-(3-methoxypyrrolidin-1-yl)-2-[3-(trifluoromethoxy)phenyl]ethanamine.
| Compound Name | 2-(3-methoxypyrrolidin-1-yl)-2-[3-(trifluoromethoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 107104696 |
| Molecular Formula | C14H19F3N2O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 2-(3-methoxypyrrolidin-1-yl)-2-[3-(trifluoromethoxy)phenyl]ethanamine |
| SMILES | COC1CCN(C(CN)c2cccc(OC(F)(F)F)c2)C1 |
| InChI | InChI=1S/C14H19F3N2O2/c1-20-12-5-6-19(9-12)13(8-18)10-3-2-4-11(7-10)21-14(15,16)17/h2-4,7,12-13H,5-6,8-9,18H2,1H3 |
| InChIKey | UTQJJDBDFDFLAP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |