C15H23FN2O2 — CID 65096664
2-(3-fluoro-4-methoxyphenyl)-2-(4-methoxypiperidin-1-yl)ethanamine (PubChem CID 65096664) has the molecular formula C15H23FN2O2 and a molecular weight of 282.36 g/mol. Its IUPAC name is 2-(3-fluoro-4-methoxyphenyl)-2-(4-methoxypiperidin-1-yl)ethanamine.
| Compound Name | 2-(3-fluoro-4-methoxyphenyl)-2-(4-methoxypiperidin-1-yl)ethanamine |
|---|---|
| PubChem CID | 65096664 |
| Molecular Formula | C15H23FN2O2 |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 2-(3-fluoro-4-methoxyphenyl)-2-(4-methoxypiperidin-1-yl)ethanamine |
| SMILES | COc1ccc(C(CN)N2CCC(OC)CC2)cc1F |
| InChI | InChI=1S/C15H23FN2O2/c1-19-12-5-7-18(8-6-12)14(10-17)11-3-4-15(20-2)13(16)9-11/h3-4,9,12,14H,5-8,10,17H2,1-2H3 |
| InChIKey | AUXCRGOINHPIGG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |