C17H25FN2O — CID 82752173
2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-(3-fluoro-4-methoxyphenyl)ethanamine (PubChem CID 82752173) has the molecular formula C17H25FN2O and a molecular weight of 292.40 g/mol. Its IUPAC name is 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-(3-fluoro-4-methoxyphenyl)ethanamine.
| Compound Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-(3-fluoro-4-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 82752173 |
| Molecular Formula | C17H25FN2O |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-(3-fluoro-4-methoxyphenyl)ethanamine |
| SMILES | COc1ccc(C(CN)N2CCC3CCCCC32)cc1F |
| InChI | InChI=1S/C17H25FN2O/c1-21-17-7-6-13(10-14(17)18)16(11-19)20-9-8-12-4-2-3-5-15(12)20/h6-7,10,12,15-16H,2-5,8-9,11,19H2,1H3 |
| InChIKey | NHTYHITXBBSZBB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |