C17H24N2O2 — CID 82752184
2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-(1,3-benzodioxol-5-yl)ethanamine (PubChem CID 82752184) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-(1,3-benzodioxol-5-yl)ethanamine.
| Compound Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-(1,3-benzodioxol-5-yl)ethanamine |
|---|---|
| PubChem CID | 82752184 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-(1,3-benzodioxol-5-yl)ethanamine |
| SMILES | NCC(c1ccc2c(c1)OCO2)N1CCC2CCCCC21 |
| InChI | InChI=1S/C17H24N2O2/c18-10-15(13-5-6-16-17(9-13)21-11-20-16)19-8-7-12-3-1-2-4-14(12)19/h5-6,9,12,14-15H,1-4,7-8,10-11,18H2 |
| InChIKey | CJIATCILAQJGHU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |