C13H14N2O2 — CID 82021304
2-(1,3-benzodioxol-5-yl)-2-pyrrol-1-ylethanamine (PubChem CID 82021304) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-2-pyrrol-1-ylethanamine.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-2-pyrrol-1-ylethanamine |
|---|---|
| PubChem CID | 82021304 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-2-pyrrol-1-ylethanamine |
| SMILES | NCC(c1ccc2c(c1)OCO2)n1cccc1 |
| InChI | InChI=1S/C13H14N2O2/c14-8-11(15-5-1-2-6-15)10-3-4-12-13(7-10)17-9-16-12/h1-7,11H,8-9,14H2 |
| InChIKey | UJYAUIBSSXLJHD-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |