C16H16FNO2 — CID 82140472
2-(1,3-benzodioxol-5-yl)-3-(3-fluorophenyl)propan-1-amine (PubChem CID 82140472) has the molecular formula C16H16FNO2 and a molecular weight of 273.31 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-3-(3-fluorophenyl)propan-1-amine.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-3-(3-fluorophenyl)propan-1-amine |
|---|---|
| PubChem CID | 82140472 |
| Molecular Formula | C16H16FNO2 |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-3-(3-fluorophenyl)propan-1-amine |
| SMILES | NCC(Cc1cccc(F)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H16FNO2/c17-14-3-1-2-11(7-14)6-13(9-18)12-4-5-15-16(8-12)20-10-19-15/h1-5,7-8,13H,6,9-10,18H2 |
| InChIKey | JUSQKAVCHNMPQY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |