C15H15F2N — CID 15014589
3-(3-fluorophenyl)-2-(4-fluorophenyl)propan-1-amine (PubChem CID 15014589) has the molecular formula C15H15F2N and a molecular weight of 247.29 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-2-(4-fluorophenyl)propan-1-amine.
| Compound Name | 3-(3-fluorophenyl)-2-(4-fluorophenyl)propan-1-amine |
|---|---|
| PubChem CID | 15014589 |
| Molecular Formula | C15H15F2N |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 3-(3-fluorophenyl)-2-(4-fluorophenyl)propan-1-amine |
| SMILES | NCC(Cc1cccc(F)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H15F2N/c16-14-6-4-12(5-7-14)13(10-18)8-11-2-1-3-15(17)9-11/h1-7,9,13H,8,10,18H2 |
| InChIKey | XXSGHFDOMMZQON-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |