C10H12F3N — CID 84721552
3,3-difluoro-2-[(3-fluorophenyl)methyl]propan-1-amine (PubChem CID 84721552) has the molecular formula C10H12F3N and a molecular weight of 203.21 g/mol. Its IUPAC name is 3,3-difluoro-2-[(3-fluorophenyl)methyl]propan-1-amine.
| Compound Name | 3,3-difluoro-2-[(3-fluorophenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 84721552 |
| Molecular Formula | C10H12F3N |
| Molecular Weight | 203.21 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 3,3-difluoro-2-[(3-fluorophenyl)methyl]propan-1-amine |
| SMILES | NCC(Cc1cccc(F)c1)C(F)F |
| InChI | InChI=1S/C10H12F3N/c11-9-3-1-2-7(5-9)4-8(6-14)10(12)13/h1-3,5,8,10H,4,6,14H2 |
| InChIKey | NPICRVNTHRNJJW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.21 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |