C17H21FN2 — CID 82139525
4-[1-amino-3-(4-fluorophenyl)propan-2-yl]-N,N-dimethylaniline (PubChem CID 82139525) has the molecular formula C17H21FN2 and a molecular weight of 272.37 g/mol. Its IUPAC name is 4-[1-amino-3-(4-fluorophenyl)propan-2-yl]-N,N-dimethylaniline.
| Compound Name | 4-[1-amino-3-(4-fluorophenyl)propan-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 82139525 |
| Molecular Formula | C17H21FN2 |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 4-[1-amino-3-(4-fluorophenyl)propan-2-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C(CN)Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H21FN2/c1-20(2)17-9-5-14(6-10-17)15(12-19)11-13-3-7-16(18)8-4-13/h3-10,15H,11-12,19H2,1-2H3 |
| InChIKey | UTIHWXVDFIWPJV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|