C22H32N2 — CID 83973083
4-[3-amino-2-(4-propan-2-ylphenyl)propyl]-N,N-diethylaniline (PubChem CID 83973083) has the molecular formula C22H32N2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 4-[3-amino-2-(4-propan-2-ylphenyl)propyl]-N,N-diethylaniline.
| Compound Name | 4-[3-amino-2-(4-propan-2-ylphenyl)propyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 83973083 |
| Molecular Formula | C22H32N2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | 4-[3-amino-2-(4-propan-2-ylphenyl)propyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(CC(CN)c2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H32N2/c1-5-24(6-2)22-13-7-18(8-14-22)15-21(16-23)20-11-9-19(10-12-20)17(3)4/h7-14,17,21H,5-6,15-16,23H2,1-4H3 |
| InChIKey | AWVRSBUYESGVLZ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|