C21H26FN3 — CID 83976530
4-[3-amino-2-(5-fluoro-1H-indol-3-yl)propyl]-N,N-diethylaniline (PubChem CID 83976530) has the molecular formula C21H26FN3 and a molecular weight of 339.46 g/mol. Its IUPAC name is 4-[3-amino-2-(5-fluoro-1H-indol-3-yl)propyl]-N,N-diethylaniline.
| Compound Name | 4-[3-amino-2-(5-fluoro-1H-indol-3-yl)propyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 83976530 |
| Molecular Formula | C21H26FN3 |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | 4-[3-amino-2-(5-fluoro-1H-indol-3-yl)propyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(CC(CN)c2c[nH]c3ccc(F)cc23)cc1 |
| InChI | InChI=1S/C21H26FN3/c1-3-25(4-2)18-8-5-15(6-9-18)11-16(13-23)20-14-24-21-10-7-17(22)12-19(20)21/h5-10,12,14,16,24H,3-4,11,13,23H2,1-2H3 |
| InChIKey | BWGULJNHVRXZDK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|