C22H24FN3 — CID 112539142
3-(1-ethyl-2-methylindol-3-yl)-2-(5-fluoro-1H-indol-3-yl)propan-1-amine (PubChem CID 112539142) has the molecular formula C22H24FN3 and a molecular weight of 349.45 g/mol. Its IUPAC name is 3-(1-ethyl-2-methylindol-3-yl)-2-(5-fluoro-1H-indol-3-yl)propan-1-amine.
| Compound Name | 3-(1-ethyl-2-methylindol-3-yl)-2-(5-fluoro-1H-indol-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 112539142 |
| Molecular Formula | C22H24FN3 |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 3-(1-ethyl-2-methylindol-3-yl)-2-(5-fluoro-1H-indol-3-yl)propan-1-amine |
| SMILES | CCn1c(C)c(CC(CN)c2c[nH]c3ccc(F)cc23)c2ccccc21 |
| InChI | InChI=1S/C22H24FN3/c1-3-26-14(2)18(17-6-4-5-7-22(17)26)10-15(12-24)20-13-25-21-9-8-16(23)11-19(20)21/h4-9,11,13,15,25H,3,10,12,24H2,1-2H3 |
| InChIKey | IOBFCVXYCZGOJM-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 46.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|