C17H16Cl2N2 — CID 83976328
3-(2,6-dichlorophenyl)-2-(1H-indol-3-yl)propan-1-amine (PubChem CID 83976328) has the molecular formula C17H16Cl2N2 and a molecular weight of 319.24 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-2-(1H-indol-3-yl)propan-1-amine.
| Compound Name | 3-(2,6-dichlorophenyl)-2-(1H-indol-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 83976328 |
| Molecular Formula | C17H16Cl2N2 |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-2-(1H-indol-3-yl)propan-1-amine |
| SMILES | NCC(Cc1c(Cl)cccc1Cl)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H16Cl2N2/c18-15-5-3-6-16(19)13(15)8-11(9-20)14-10-21-17-7-2-1-4-12(14)17/h1-7,10-11,21H,8-9,20H2 |
| InChIKey | AAIDUEMNGAMNLY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |