C13H19N3 — CID 171217468
(1S)-1-(1H-indol-3-yl)pentane-1,5-diamine (PubChem CID 171217468) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is (1S)-1-(1H-indol-3-yl)pentane-1,5-diamine.
| Compound Name | (1S)-1-(1H-indol-3-yl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 171217468 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | (1S)-1-(1H-indol-3-yl)pentane-1,5-diamine |
| SMILES | NCCCC[C@H](N)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C13H19N3/c14-8-4-3-6-12(15)11-9-16-13-7-2-1-5-10(11)13/h1-2,5,7,9,12,16H,3-4,6,8,14-15H2/t12-/m0/s1 |
| InChIKey | SFYQIWJWCKUAJZ-LBPRGKRZSA-N |
| XLogP | 2.30 |
| TPSA | 67.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|