C13H20ClN3 — CID 171205497
(1R)-1-(1H-indol-4-yl)pentane-1,5-diamine;hydrochloride (PubChem CID 171205497) has the molecular formula C13H20ClN3 and a molecular weight of 253.78 g/mol. Its IUPAC name is (1R)-1-(1H-indol-4-yl)pentane-1,5-diamine;hydrochloride.
| Compound Name | (1R)-1-(1H-indol-4-yl)pentane-1,5-diamine;hydrochloride |
|---|---|
| PubChem CID | 171205497 |
| Molecular Formula | C13H20ClN3 |
| Molecular Weight | 253.78 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | (1R)-1-(1H-indol-4-yl)pentane-1,5-diamine;hydrochloride |
| SMILES | Cl.NCCCC[C@@H](N)c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C13H19N3.ClH/c14-8-2-1-5-12(15)10-4-3-6-13-11(10)7-9-16-13;/h3-4,6-7,9,12,16H,1-2,5,8,14-15H2;1H/t12-;/m1./s1 |
| InChIKey | WYPGNEABFPRXJY-UTONKHPSSA-N |
| XLogP | 2.72 |
| TPSA | 67.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.78 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|