C12H16N2O — CID 171205537
(4R)-4-amino-4-(1H-indol-4-yl)butan-1-ol (PubChem CID 171205537) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is (4R)-4-amino-4-(1H-indol-4-yl)butan-1-ol.
| Compound Name | (4R)-4-amino-4-(1H-indol-4-yl)butan-1-ol |
|---|---|
| PubChem CID | 171205537 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | (4R)-4-amino-4-(1H-indol-4-yl)butan-1-ol |
| SMILES | N[C@H](CCCO)c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C12H16N2O/c13-11(4-2-8-15)9-3-1-5-12-10(9)6-7-14-12/h1,3,5-7,11,14-15H,2,4,8,13H2/t11-/m1/s1 |
| InChIKey | YMOKNRILNBHYTF-LLVKDONJSA-N |
| XLogP | 1.94 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |