C13H16N2 — CID 171225082
(1S)-2-cyclopropyl-1-(1H-indol-4-yl)ethanamine (PubChem CID 171225082) has the molecular formula C13H16N2 and a molecular weight of 200.29 g/mol. Its IUPAC name is (1S)-2-cyclopropyl-1-(1H-indol-4-yl)ethanamine.
| Compound Name | (1S)-2-cyclopropyl-1-(1H-indol-4-yl)ethanamine |
|---|---|
| PubChem CID | 171225082 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | (1S)-2-cyclopropyl-1-(1H-indol-4-yl)ethanamine |
| SMILES | N[C@@H](CC1CC1)c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C13H16N2/c14-12(8-9-4-5-9)10-2-1-3-13-11(10)6-7-15-13/h1-3,6-7,9,12,15H,4-5,8,14H2/t12-/m0/s1 |
| InChIKey | SEQIPWJLXURQMO-LBPRGKRZSA-N |
| XLogP | 2.97 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |