C15H20N2O — CID 171262554
(1S,2R)-2-amino-1-cyclopentyl-2-(1H-indol-4-yl)ethanol (PubChem CID 171262554) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is (1S,2R)-2-amino-1-cyclopentyl-2-(1H-indol-4-yl)ethanol.
| Compound Name | (1S,2R)-2-amino-1-cyclopentyl-2-(1H-indol-4-yl)ethanol |
|---|---|
| PubChem CID | 171262554 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (1S,2R)-2-amino-1-cyclopentyl-2-(1H-indol-4-yl)ethanol |
| SMILES | N[C@H](c1cccc2[nH]ccc12)[C@@H](O)C1CCCC1 |
| InChI | InChI=1S/C15H20N2O/c16-14(15(18)10-4-1-2-5-10)12-6-3-7-13-11(12)8-9-17-13/h3,6-10,14-15,17-18H,1-2,4-5,16H2/t14-,15+/m1/s1 |
| InChIKey | NAHKKABNUBMIJI-CABCVRRESA-N |
| XLogP | 2.72 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |