C13H19ClN2O — CID 171262567
(1R,2S)-1-amino-1-(1H-indol-4-yl)pentan-2-ol;hydrochloride (PubChem CID 171262567) has the molecular formula C13H19ClN2O and a molecular weight of 254.76 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(1H-indol-4-yl)pentan-2-ol;hydrochloride.
| Compound Name | (1R,2S)-1-amino-1-(1H-indol-4-yl)pentan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171262567 |
| Molecular Formula | C13H19ClN2O |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | (1R,2S)-1-amino-1-(1H-indol-4-yl)pentan-2-ol;hydrochloride |
| SMILES | CCC[C@H](O)[C@H](N)c1cccc2[nH]ccc12.Cl |
| InChI | InChI=1S/C13H18N2O.ClH/c1-2-4-12(16)13(14)10-5-3-6-11-9(10)7-8-15-11;/h3,5-8,12-13,15-16H,2,4,14H2,1H3;1H/t12-,13+;/m0./s1 |
| InChIKey | MAQPLTYVASTTID-JHEYCYPBSA-N |
| XLogP | 2.75 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |