C12H20N2O — CID 19366084
2-(1,6-diaminohexyl)phenol (PubChem CID 19366084) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is 2-(1,6-diaminohexyl)phenol.
| Compound Name | 2-(1,6-diaminohexyl)phenol |
|---|---|
| PubChem CID | 19366084 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 2-(1,6-diaminohexyl)phenol |
| SMILES | NCCCCCC(N)c1ccccc1O |
| InChI | InChI=1S/C12H20N2O/c13-9-5-1-2-7-11(14)10-6-3-4-8-12(10)15/h3-4,6,8,11,15H,1-2,5,7,9,13-14H2 |
| InChIKey | BNXCDFTVDHKAOF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|