C9H14N2O — CID 130872287
2-[(1S)-1,3-diaminopropyl]phenol (PubChem CID 130872287) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-[(1S)-1,3-diaminopropyl]phenol.
| Compound Name | 2-[(1S)-1,3-diaminopropyl]phenol |
|---|---|
| PubChem CID | 130872287 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 2-[(1S)-1,3-diaminopropyl]phenol |
| SMILES | NCC[C@H](N)c1ccccc1O |
| InChI | InChI=1S/C9H14N2O/c10-6-5-8(11)7-3-1-2-4-9(7)12/h1-4,8,12H,5-6,10-11H2/t8-/m0/s1 |
| InChIKey | FVRUENVUZRMLKN-QMMMGPOBSA-N |
| XLogP | 0.74 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|