C12H18ClF3N2S — CID 171231380
(1S)-1-[2-(trifluoromethylsulfanyl)phenyl]pentane-1,5-diamine;hydrochloride (PubChem CID 171231380) has the molecular formula C12H18ClF3N2S and a molecular weight of 314.80 g/mol. Its IUPAC name is (1S)-1-[2-(trifluoromethylsulfanyl)phenyl]pentane-1,5-diamine;hydrochloride.
| Compound Name | (1S)-1-[2-(trifluoromethylsulfanyl)phenyl]pentane-1,5-diamine;hydrochloride |
|---|---|
| PubChem CID | 171231380 |
| Molecular Formula | C12H18ClF3N2S |
| Molecular Weight | 314.80 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | (1S)-1-[2-(trifluoromethylsulfanyl)phenyl]pentane-1,5-diamine;hydrochloride |
| SMILES | Cl.NCCCC[C@H](N)c1ccccc1SC(F)(F)F |
| InChI | InChI=1S/C12H17F3N2S.ClH/c13-12(14,15)18-11-7-2-1-5-9(11)10(17)6-3-4-8-16;/h1-2,5,7,10H,3-4,6,8,16-17H2;1H/t10-;/m0./s1 |
| InChIKey | MMWYZLQGHHLDIK-PPHPATTJSA-N |
| XLogP | 3.85 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.80 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|