C12H15ClF3NS — CID 171231397
(1S)-2-cyclopropyl-1-[2-(trifluoromethylsulfanyl)phenyl]ethanamine;hydrochloride (PubChem CID 171231397) has the molecular formula C12H15ClF3NS and a molecular weight of 297.77 g/mol. Its IUPAC name is (1S)-2-cyclopropyl-1-[2-(trifluoromethylsulfanyl)phenyl]ethanamine;hydrochloride.
| Compound Name | (1S)-2-cyclopropyl-1-[2-(trifluoromethylsulfanyl)phenyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 171231397 |
| Molecular Formula | C12H15ClF3NS |
| Molecular Weight | 297.77 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | (1S)-2-cyclopropyl-1-[2-(trifluoromethylsulfanyl)phenyl]ethanamine;hydrochloride |
| SMILES | Cl.N[C@@H](CC1CC1)c1ccccc1SC(F)(F)F |
| InChI | InChI=1S/C12H14F3NS.ClH/c13-12(14,15)17-11-4-2-1-3-9(11)10(16)7-8-5-6-8;/h1-4,8,10H,5-7,16H2;1H/t10-;/m0./s1 |
| InChIKey | SCTOECSGENYQTQ-PPHPATTJSA-N |
| XLogP | 4.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.77 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |