C11H14BrN — CID 64906387
1-(2-bromophenyl)-2-cyclopropylethanamine (PubChem CID 64906387) has the molecular formula C11H14BrN and a molecular weight of 240.14 g/mol. Its IUPAC name is 1-(2-bromophenyl)-2-cyclopropylethanamine.
| Compound Name | 1-(2-bromophenyl)-2-cyclopropylethanamine |
|---|---|
| PubChem CID | 64906387 |
| Molecular Formula | C11H14BrN |
| Molecular Weight | 240.14 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 1-(2-bromophenyl)-2-cyclopropylethanamine |
| SMILES | NC(CC1CC1)c1ccccc1Br |
| InChI | InChI=1S/C11H14BrN/c12-10-4-2-1-3-9(10)11(13)7-8-5-6-8/h1-4,8,11H,5-7,13H2 |
| InChIKey | VDDDGEHCOZZUNY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.14 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |