C12H14F3NS — CID 171231404
(S)-cyclobutyl-[2-(trifluoromethylsulfanyl)phenyl]methanamine (PubChem CID 171231404) has the molecular formula C12H14F3NS and a molecular weight of 261.31 g/mol. Its IUPAC name is (S)-cyclobutyl-[2-(trifluoromethylsulfanyl)phenyl]methanamine.
| Compound Name | (S)-cyclobutyl-[2-(trifluoromethylsulfanyl)phenyl]methanamine |
|---|---|
| PubChem CID | 171231404 |
| Molecular Formula | C12H14F3NS |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | (S)-cyclobutyl-[2-(trifluoromethylsulfanyl)phenyl]methanamine |
| SMILES | N[C@H](c1ccccc1SC(F)(F)F)C1CCC1 |
| InChI | InChI=1S/C12H14F3NS/c13-12(14,15)17-10-7-2-1-6-9(10)11(16)8-4-3-5-8/h1-2,6-8,11H,3-5,16H2/t11-/m0/s1 |
| InChIKey | ZRHALZKZUCYTQB-NSHDSACASA-N |
| XLogP | 4.10 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |