C14H23NOS — CID 171214909
(4R)-4-amino-4-(2-tert-butylsulfanylphenyl)butan-1-ol (PubChem CID 171214909) has the molecular formula C14H23NOS and a molecular weight of 253.41 g/mol. Its IUPAC name is (4R)-4-amino-4-(2-tert-butylsulfanylphenyl)butan-1-ol.
| Compound Name | (4R)-4-amino-4-(2-tert-butylsulfanylphenyl)butan-1-ol |
|---|---|
| PubChem CID | 171214909 |
| Molecular Formula | C14H23NOS |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | (4R)-4-amino-4-(2-tert-butylsulfanylphenyl)butan-1-ol |
| SMILES | CC(C)(C)Sc1ccccc1[C@H](N)CCCO |
| InChI | InChI=1S/C14H23NOS/c1-14(2,3)17-13-9-5-4-7-11(13)12(15)8-6-10-16/h4-5,7,9,12,16H,6,8,10,15H2,1-3H3/t12-/m1/s1 |
| InChIKey | YLSPCKWWFPDHSQ-GFCCVEGCSA-N |
| XLogP | 3.35 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |