C13H21NOS — CID 171271209
(1S,2R)-1-amino-1-(2-tert-butylsulfanylphenyl)propan-2-ol (PubChem CID 171271209) has the molecular formula C13H21NOS and a molecular weight of 239.38 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-(2-tert-butylsulfanylphenyl)propan-2-ol.
| Compound Name | (1S,2R)-1-amino-1-(2-tert-butylsulfanylphenyl)propan-2-ol |
|---|---|
| PubChem CID | 171271209 |
| Molecular Formula | C13H21NOS |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | (1S,2R)-1-amino-1-(2-tert-butylsulfanylphenyl)propan-2-ol |
| SMILES | C[C@@H](O)[C@@H](N)c1ccccc1SC(C)(C)C |
| InChI | InChI=1S/C13H21NOS/c1-9(15)12(14)10-7-5-6-8-11(10)16-13(2,3)4/h5-9,12,15H,14H2,1-4H3/t9-,12-/m1/s1 |
| InChIKey | VUWIRVRJZLORLH-BXKDBHETSA-N |
| XLogP | 2.96 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |