C12H16F3NS — CID 66511757
(1R)-1-(2-tert-butylsulfanylphenyl)-2,2,2-trifluoroethanamine (PubChem CID 66511757) has the molecular formula C12H16F3NS and a molecular weight of 263.33 g/mol. Its IUPAC name is (1R)-1-(2-tert-butylsulfanylphenyl)-2,2,2-trifluoroethanamine.
| Compound Name | (1R)-1-(2-tert-butylsulfanylphenyl)-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 66511757 |
| Molecular Formula | C12H16F3NS |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | (1R)-1-(2-tert-butylsulfanylphenyl)-2,2,2-trifluoroethanamine |
| SMILES | CC(C)(C)Sc1ccccc1[C@@H](N)C(F)(F)F |
| InChI | InChI=1S/C12H16F3NS/c1-11(2,3)17-9-7-5-4-6-8(9)10(16)12(13,14)15/h4-7,10H,16H2,1-3H3/t10-/m1/s1 |
| InChIKey | HSZFXGLNZQQCFU-SNVBAGLBSA-N |
| XLogP | 4.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |