C15H24ClNS — CID 171234529
(1S)-1-(2-tert-butylsulfanylphenyl)-3-methylbut-3-en-1-amine;hydrochloride (PubChem CID 171234529) has the molecular formula C15H24ClNS and a molecular weight of 285.88 g/mol. Its IUPAC name is (1S)-1-(2-tert-butylsulfanylphenyl)-3-methylbut-3-en-1-amine;hydrochloride.
| Compound Name | (1S)-1-(2-tert-butylsulfanylphenyl)-3-methylbut-3-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171234529 |
| Molecular Formula | C15H24ClNS |
| Molecular Weight | 285.88 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | (1S)-1-(2-tert-butylsulfanylphenyl)-3-methylbut-3-en-1-amine;hydrochloride |
| SMILES | C=C(C)C[C@H](N)c1ccccc1SC(C)(C)C.Cl |
| InChI | InChI=1S/C15H23NS.ClH/c1-11(2)10-13(16)12-8-6-7-9-14(12)17-15(3,4)5;/h6-9,13H,1,10,16H2,2-5H3;1H/t13-;/m0./s1 |
| InChIKey | JIZWYKZIJFRVGU-ZOWNYOTGSA-N |
| XLogP | 4.97 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.88 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|