C13H19ClN2S — CID 171260201
(3S)-3-amino-3-(2-tert-butylsulfanylphenyl)propanenitrile;hydrochloride (PubChem CID 171260201) has the molecular formula C13H19ClN2S and a molecular weight of 270.83 g/mol. Its IUPAC name is (3S)-3-amino-3-(2-tert-butylsulfanylphenyl)propanenitrile;hydrochloride.
| Compound Name | (3S)-3-amino-3-(2-tert-butylsulfanylphenyl)propanenitrile;hydrochloride |
|---|---|
| PubChem CID | 171260201 |
| Molecular Formula | C13H19ClN2S |
| Molecular Weight | 270.83 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | (3S)-3-amino-3-(2-tert-butylsulfanylphenyl)propanenitrile;hydrochloride |
| SMILES | CC(C)(C)Sc1ccccc1[C@@H](N)CC#N.Cl |
| InChI | InChI=1S/C13H18N2S.ClH/c1-13(2,3)16-12-7-5-4-6-10(12)11(15)8-9-14;/h4-7,11H,8,15H2,1-3H3;1H/t11-;/m0./s1 |
| InChIKey | JDZAXEZOXFRYSC-MERQFXBCSA-N |
| XLogP | 3.91 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.83 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |