C15H23N3O — CID 163917154
1-[[(5R)-5-amino-5-(1H-indol-3-yl)pentyl]amino]ethanol (PubChem CID 163917154) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is 1-[[(5R)-5-amino-5-(1H-indol-3-yl)pentyl]amino]ethanol.
| Compound Name | 1-[[(5R)-5-amino-5-(1H-indol-3-yl)pentyl]amino]ethanol |
|---|---|
| PubChem CID | 163917154 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | 1-[[(5R)-5-amino-5-(1H-indol-3-yl)pentyl]amino]ethanol |
| SMILES | CC(O)NCCCC[C@@H](N)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C15H23N3O/c1-11(19)17-9-5-4-7-14(16)13-10-18-15-8-3-2-6-12(13)15/h2-3,6,8,10-11,14,17-19H,4-5,7,9,16H2,1H3/t11?,14-/m1/s1 |
| InChIKey | QXGKJKSCTQFPFU-SBXXRYSUSA-N |
| XLogP | 2.27 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|