C12H17N3 — CID 116934899
N'-ethyl-1-(1H-indol-3-yl)ethane-1,2-diamine (PubChem CID 116934899) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is N'-ethyl-1-(1H-indol-3-yl)ethane-1,2-diamine.
| Compound Name | N'-ethyl-1-(1H-indol-3-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 116934899 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | N'-ethyl-1-(1H-indol-3-yl)ethane-1,2-diamine |
| SMILES | CCNCC(N)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C12H17N3/c1-2-14-8-11(13)10-7-15-12-6-4-3-5-9(10)12/h3-7,11,14-15H,2,8,13H2,1H3 |
| InChIKey | NOKIONLHQTXNCE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |