C11H15N3 — CID 116909089
1-(1H-indol-3-yl)-N',N'-dimethylmethanediamine (PubChem CID 116909089) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 1-(1H-indol-3-yl)-N',N'-dimethylmethanediamine.
| Compound Name | 1-(1H-indol-3-yl)-N',N'-dimethylmethanediamine |
|---|---|
| PubChem CID | 116909089 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 1-(1H-indol-3-yl)-N',N'-dimethylmethanediamine |
| SMILES | CN(C)C(N)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C11H15N3/c1-14(2)11(12)9-7-13-10-6-4-3-5-8(9)10/h3-7,11,13H,12H2,1-2H3 |
| InChIKey | JEMDTUNYYCEWGL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|