C10H9F3N2 — CID 42553559
(1R)-2,2,2-trifluoro-1-(1H-indol-3-yl)ethanamine (PubChem CID 42553559) has the molecular formula C10H9F3N2 and a molecular weight of 214.19 g/mol. Its IUPAC name is (1R)-2,2,2-trifluoro-1-(1H-indol-3-yl)ethanamine.
| Compound Name | (1R)-2,2,2-trifluoro-1-(1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 42553559 |
| Molecular Formula | C10H9F3N2 |
| Molecular Weight | 214.19 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | (1R)-2,2,2-trifluoro-1-(1H-indol-3-yl)ethanamine |
| SMILES | N[C@H](c1c[nH]c2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C10H9F3N2/c11-10(12,13)9(14)7-5-15-8-4-2-1-3-6(7)8/h1-5,9,15H,14H2/t9-/m1/s1 |
| InChIKey | TZQBOSKCYLEGAX-SECBINFHSA-N |
| XLogP | 2.73 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.19 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |