C18H12BrF3N2 — CID 78321201
5-bromo-3-[2,2,2-trifluoro-1-(1H-indol-3-yl)ethyl]-1H-indole (PubChem CID 78321201) has the molecular formula C18H12BrF3N2 and a molecular weight of 393.21 g/mol. Its IUPAC name is 5-bromo-3-[2,2,2-trifluoro-1-(1H-indol-3-yl)ethyl]-1H-indole.
| Compound Name | 5-bromo-3-[2,2,2-trifluoro-1-(1H-indol-3-yl)ethyl]-1H-indole |
|---|---|
| PubChem CID | 78321201 |
| Molecular Formula | C18H12BrF3N2 |
| Molecular Weight | 393.21 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | 5-bromo-3-[2,2,2-trifluoro-1-(1H-indol-3-yl)ethyl]-1H-indole |
| SMILES | FC(F)(F)C(c1c[nH]c2ccccc12)c1c[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C18H12BrF3N2/c19-10-5-6-16-12(7-10)14(9-24-16)17(18(20,21)22)13-8-23-15-4-2-1-3-11(13)15/h1-9,17,23-24H |
| InChIKey | XUBLVFLZTOSBLP-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.21 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |