C13H18N2 — CID 131535143
(1R)-1-(1H-indol-3-yl)-2,2-dimethylpropan-1-amine (PubChem CID 131535143) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is (1R)-1-(1H-indol-3-yl)-2,2-dimethylpropan-1-amine.
| Compound Name | (1R)-1-(1H-indol-3-yl)-2,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 131535143 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | (1R)-1-(1H-indol-3-yl)-2,2-dimethylpropan-1-amine |
| SMILES | CC(C)(C)[C@@H](N)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C13H18N2/c1-13(2,3)12(14)10-8-15-11-7-5-4-6-9(10)11/h4-8,12,15H,14H2,1-3H3/t12-/m0/s1 |
| InChIKey | WMAKZZJSZZLBEC-LBPRGKRZSA-N |
| XLogP | 3.21 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |